C18H23ClN2O2S — CID 102062642
(4R,5R)-5-(4-chlorophenyl)-N-cyclohexyl-4,5-dimethyl-2-oxo-1,3-thiazolidine-3-carboxamide (PubChem CID 102062642) has the molecular formula C18H23ClN2O2S and a molecular weight of 366.91 g/mol. Its IUPAC name is (4R,5R)-5-(4-chlorophenyl)-N-cyclohexyl-4,5-dimethyl-2-oxo-1,3-thiazolidine-3-carboxamide.
| Compound Name | (4R,5R)-5-(4-chlorophenyl)-N-cyclohexyl-4,5-dimethyl-2-oxo-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 102062642 |
| Molecular Formula | C18H23ClN2O2S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (4R,5R)-5-(4-chlorophenyl)-N-cyclohexyl-4,5-dimethyl-2-oxo-1,3-thiazolidine-3-carboxamide |
| SMILES | C[C@H]1N(C(=O)NC2CCCCC2)C(=O)S[C@]1(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClN2O2S/c1-12-18(2,13-8-10-14(19)11-9-13)24-17(23)21(12)16(22)20-15-6-4-3-5-7-15/h8-12,15H,3-7H2,1-2H3,(H,20,22)/t12-,18+/m1/s1 |
| InChIKey | KWURGAXXYALBHD-XIKOKIGWSA-N |
| XLogP | 5.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|