C22H25OP — CID 102062769
(1R,4R,7R)-7-(diphenylphosphanylmethyl)-1,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 102062769) has the molecular formula C22H25OP and a molecular weight of 336.42 g/mol. Its IUPAC name is (1R,4R,7R)-7-(diphenylphosphanylmethyl)-1,7-dimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,4R,7R)-7-(diphenylphosphanylmethyl)-1,7-dimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 102062769 |
| Molecular Formula | C22H25OP |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (1R,4R,7R)-7-(diphenylphosphanylmethyl)-1,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | C[C@]12CC[C@H](CC1=O)[C@@]2(C)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25OP/c1-21-14-13-17(15-20(21)23)22(21,2)16-24(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,17H,13-16H2,1-2H3/t17-,21+,22-/m1/s1 |
| InChIKey | GPJQQSBZBFUNRO-VOQZNFBZSA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|