C10H9F3O3 — CID 102063010
(3S,5R)-5-methyl-3-phenyl-3-(trifluoromethyl)-1,2,4-trioxolane (PubChem CID 102063010) has the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. Its IUPAC name is (3S,5R)-5-methyl-3-phenyl-3-(trifluoromethyl)-1,2,4-trioxolane.
| Compound Name | (3S,5R)-5-methyl-3-phenyl-3-(trifluoromethyl)-1,2,4-trioxolane |
|---|---|
| PubChem CID | 102063010 |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | (3S,5R)-5-methyl-3-phenyl-3-(trifluoromethyl)-1,2,4-trioxolane |
| SMILES | C[C@H]1OO[C@@](c2ccccc2)(C(F)(F)F)O1 |
| InChI | InChI=1S/C10H9F3O3/c1-7-14-9(16-15-7,10(11,12)13)8-5-3-2-4-6-8/h2-7H,1H3/t7-,9+/m1/s1 |
| InChIKey | YVQQZNXLTLGMGJ-APPZFPTMSA-N |
| XLogP | 2.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|