C15H21NO6 — CID 102063222
methyl (3aS,7S)-3-acetyl-7-(2-methoxy-2-oxoethyl)-3a-methyl-4,5,6,7-tetrahydro-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate (PubChem CID 102063222) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is methyl (3aS,7S)-3-acetyl-7-(2-methoxy-2-oxoethyl)-3a-methyl-4,5,6,7-tetrahydro-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate.
| Compound Name | methyl (3aS,7S)-3-acetyl-7-(2-methoxy-2-oxoethyl)-3a-methyl-4,5,6,7-tetrahydro-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 102063222 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | methyl (3aS,7S)-3-acetyl-7-(2-methoxy-2-oxoethyl)-3a-methyl-4,5,6,7-tetrahydro-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate |
| SMILES | COC(=O)C[C@@H]1CCC[C@@]2(C)C(C(C)=O)=C(C(=O)OC)ON12 |
| InChI | InChI=1S/C15H21NO6/c1-9(17)12-13(14(19)21-4)22-16-10(8-11(18)20-3)6-5-7-15(12,16)2/h10H,5-8H2,1-4H3/t10-,15-/m0/s1 |
| InChIKey | RDKILGWOJQRFPT-BONVTDFDSA-N |
| XLogP | 1.12 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |