C27H21ClN4O3 — CID 10206331
4-(3-chlorophenyl)-6-[hydroxy-[4-[(Z)-hydroxyiminomethyl]phenyl]-(3-methylimidazol-4-yl)methyl]-1H-quinolin-2-one (PubChem CID 10206331) has the molecular formula C27H21ClN4O3 and a molecular weight of 484.94 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-6-[hydroxy-[4-[(Z)-hydroxyiminomethyl]phenyl]-(3-methylimidazol-4-yl)methyl]-1H-quinolin-2-one.
| Compound Name | 4-(3-chlorophenyl)-6-[hydroxy-[4-[(Z)-hydroxyiminomethyl]phenyl]-(3-methylimidazol-4-yl)methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10206331 |
| Molecular Formula | C27H21ClN4O3 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 4-(3-chlorophenyl)-6-[hydroxy-[4-[(Z)-hydroxyiminomethyl]phenyl]-(3-methylimidazol-4-yl)methyl]-1H-quinolin-2-one |
| SMILES | Cn1cncc1C(O)(c1ccc(/C=N\O)cc1)c1ccc2[nH]c(=O)cc(-c3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C27H21ClN4O3/c1-32-16-29-15-25(32)27(34,19-7-5-17(6-8-19)14-30-35)20-9-10-24-23(12-20)22(13-26(33)31-24)18-3-2-4-21(28)11-18/h2-16,34-35H,1H3,(H,31,33)/b30-14- |
| InChIKey | URFBMKWUTKMMPO-CPDSRJINSA-N |
| XLogP | 4.67 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|