C13H25NO4S — CID 102063562
methyl (2S)-2-[[(2S)-3-tert-butylsulfanyl-2-hydroxypropanoyl]amino]-3-methylbutanoate (PubChem CID 102063562) has the molecular formula C13H25NO4S and a molecular weight of 291.41 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-3-tert-butylsulfanyl-2-hydroxypropanoyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[(2S)-3-tert-butylsulfanyl-2-hydroxypropanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 102063562 |
| Molecular Formula | C13H25NO4S |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl (2S)-2-[[(2S)-3-tert-butylsulfanyl-2-hydroxypropanoyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)[C@H](O)CSC(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H25NO4S/c1-8(2)10(12(17)18-6)14-11(16)9(15)7-19-13(3,4)5/h8-10,15H,7H2,1-6H3,(H,14,16)/t9-,10+/m1/s1 |
| InChIKey | YTUNYLXWKZJNOH-ZJUUUORDSA-N |
| XLogP | 1.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |