C17H19BrO — CID 102063720
(1S,4S,5R)-4-bromo-1,5-dimethyl-7-(4-methylphenyl)bicyclo[3.2.1]oct-6-en-2-one (PubChem CID 102063720) has the molecular formula C17H19BrO and a molecular weight of 319.24 g/mol. Its IUPAC name is (1S,4S,5R)-4-bromo-1,5-dimethyl-7-(4-methylphenyl)bicyclo[3.2.1]oct-6-en-2-one.
| Compound Name | (1S,4S,5R)-4-bromo-1,5-dimethyl-7-(4-methylphenyl)bicyclo[3.2.1]oct-6-en-2-one |
|---|---|
| PubChem CID | 102063720 |
| Molecular Formula | C17H19BrO |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (1S,4S,5R)-4-bromo-1,5-dimethyl-7-(4-methylphenyl)bicyclo[3.2.1]oct-6-en-2-one |
| SMILES | Cc1ccc(C2=C[C@@]3(C)C[C@]2(C)C(=O)C[C@@H]3Br)cc1 |
| InChI | InChI=1S/C17H19BrO/c1-11-4-6-12(7-5-11)13-9-16(2)10-17(13,3)15(19)8-14(16)18/h4-7,9,14H,8,10H2,1-3H3/t14-,16-,17-/m0/s1 |
| InChIKey | HQOGULJROHDMKR-XIRDDKMYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|