About 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid
4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid (PubChem CID 102063857) has the molecular formula C11H13Cl3NO5PS
and a molecular weight of 408.63 g/mol. Its IUPAC name is 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid.
Molecular Properties
| Compound Name | 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid |
| PubChem CID | 102063857 |
| Molecular Formula | C11H13Cl3NO5PS |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 406.93 |
| IUPAC Name | 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid |
| SMILES | CCOP(=S)(OCCCC(=O)O)Oc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl3NO5PS/c1-2-18-21(22,19-5-3-4-9(16)17)20-11-8(13)6-7(12)10(14)15-11/h6H,2-5H2,1H3,(H,16,17) |
| InChIKey | UCUQEGGTUGPCGI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid?
The IUPAC name of 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid (CID 102063857) is 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid.
What is the SMILES notation for 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid?
The canonical SMILES for 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid is CCOP(=S)(OCCCC(=O)O)Oc1nc(Cl)c(Cl)cc1Cl.
What is the InChIKey of 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid?
The InChIKey is UCUQEGGTUGPCGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl3NO5PS/c1-2-18-21(22,19-5-3-4-9(16)17)20-11-8(13)6-7(12)10(14)15-11/h6H,2-5H2,1H3,(H,16,17).
What are the key properties of 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid?
4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid has a molecular weight of 408.63 g/mol, XLogP of 4.56, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[ethoxy-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]oxybutanoic acid is sourced from PubChem (CID 102063857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).