About 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one
4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one (PubChem CID 102063968) has the molecular formula C13H12Cl4N4O2
and a molecular weight of 398.08 g/mol. Its IUPAC name is 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one |
| PubChem CID | 102063968 |
| Molecular Formula | C13H12Cl4N4O2 |
| Molecular Weight | 398.08 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1CCCCCn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C13H12Cl4N4O2/c14-8-6-18-20(12(22)10(8)16)4-2-1-3-5-21-13(23)11(17)9(15)7-19-21/h6-7H,1-5H2 |
| InChIKey | XODKFWOHDRRWOI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.08 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one?
The IUPAC name of 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one (CID 102063968) is 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one.
What is the SMILES notation for 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one?
The canonical SMILES for 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one is O=c1c(Cl)c(Cl)cnn1CCCCCn1ncc(Cl)c(Cl)c1=O.
What is the InChIKey of 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one?
The InChIKey is XODKFWOHDRRWOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl4N4O2/c14-8-6-18-20(12(22)10(8)16)4-2-1-3-5-21-13(23)11(17)9(15)7-19-21/h6-7H,1-5H2.
What are the key properties of 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one?
4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one has a molecular weight of 398.08 g/mol, XLogP of 3.28, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-[5-(4,5-dichloro-6-oxopyridazin-1-yl)pentyl]pyridazin-3-one is sourced from PubChem (CID 102063968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).