C20H24F6N2O5 — CID 10206413
methyl 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(morpholine-4-carbonyl)anilino]pentanoate (PubChem CID 10206413) has the molecular formula C20H24F6N2O5 and a molecular weight of 486.41 g/mol. Its IUPAC name is methyl 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(morpholine-4-carbonyl)anilino]pentanoate.
| Compound Name | methyl 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(morpholine-4-carbonyl)anilino]pentanoate |
|---|---|
| PubChem CID | 10206413 |
| Molecular Formula | C20H24F6N2O5 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | methyl 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(morpholine-4-carbonyl)anilino]pentanoate |
| SMILES | COC(=O)CCCCN(C(=O)N1CCOCC1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H24F6N2O5/c1-32-16(29)4-2-3-9-28(17(30)27-10-12-33-13-11-27)15-7-5-14(6-8-15)18(31,19(21,22)23)20(24,25)26/h5-8,31H,2-4,9-13H2,1H3 |
| InChIKey | DKTUEVOKTCNLNR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|