C14H20BrNSe — CID 102064196
[2-[[cyclohexyl(methyl)amino]methyl]phenyl] selenohypobromite (PubChem CID 102064196) has the molecular formula C14H20BrNSe and a molecular weight of 361.19 g/mol. Its IUPAC name is [2-[[cyclohexyl(methyl)amino]methyl]phenyl] selenohypobromite.
| Compound Name | [2-[[cyclohexyl(methyl)amino]methyl]phenyl] selenohypobromite |
|---|---|
| PubChem CID | 102064196 |
| Molecular Formula | C14H20BrNSe |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | [2-[[cyclohexyl(methyl)amino]methyl]phenyl] selenohypobromite |
| SMILES | CN(Cc1ccccc1[Se]Br)C1CCCCC1 |
| InChI | InChI=1S/C14H20BrNSe/c1-16(13-8-3-2-4-9-13)11-12-7-5-6-10-14(12)17-15/h5-7,10,13H,2-4,8-9,11H2,1H3 |
| InChIKey | CPNRHSCQXPOTRV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|