C26H27Cl2NO5 — CID 102064325
(1S)-2-[(3,4-dichlorophenyl)methyl]-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinoline-6,7-diol (PubChem CID 102064325) has the molecular formula C26H27Cl2NO5 and a molecular weight of 504.41 g/mol. Its IUPAC name is (1S)-2-[(3,4-dichlorophenyl)methyl]-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinoline-6,7-diol.
| Compound Name | (1S)-2-[(3,4-dichlorophenyl)methyl]-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinoline-6,7-diol |
|---|---|
| PubChem CID | 102064325 |
| Molecular Formula | C26H27Cl2NO5 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | (1S)-2-[(3,4-dichlorophenyl)methyl]-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinoline-6,7-diol |
| SMILES | COc1cc(C[C@H]2c3cc(O)c(O)cc3CCN2Cc2ccc(Cl)c(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C26H27Cl2NO5/c1-32-24-10-16(11-25(33-2)26(24)34-3)9-21-18-13-23(31)22(30)12-17(18)6-7-29(21)14-15-4-5-19(27)20(28)8-15/h4-5,8,10-13,21,30-31H,6-7,9,14H2,1-3H3/t21-/m0/s1 |
| InChIKey | NNDDTWYUXODCOR-NRFANRHFSA-N |
| XLogP | 5.77 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|