C28H32F2O3S — CID 10206438
(E)-3-[4-[3,5-ditert-butyl-2-(2,2-difluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoic acid (PubChem CID 10206438) has the molecular formula C28H32F2O3S and a molecular weight of 486.62 g/mol. Its IUPAC name is (E)-3-[4-[3,5-ditert-butyl-2-(2,2-difluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoic acid.
| Compound Name | (E)-3-[4-[3,5-ditert-butyl-2-(2,2-difluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 10206438 |
| Molecular Formula | C28H32F2O3S |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (E)-3-[4-[3,5-ditert-butyl-2-(2,2-difluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)c1cc2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3OCC(F)F)cccc2s1 |
| InChI | InChI=1S/C28H32F2O3S/c1-16(11-25(31)32)23-14-19-18(9-8-10-22(19)34-23)20-12-17(27(2,3)4)13-21(28(5,6)7)26(20)33-15-24(29)30/h8-14,24H,15H2,1-7H3,(H,31,32)/b16-11+ |
| InChIKey | HDGYNNANHOVHIN-LFIBNONCSA-N |
| XLogP | 8.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|