About (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane
(3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane (PubChem CID 102064386) has the molecular formula C16H26Si3
and a molecular weight of 302.64 g/mol. Its IUPAC name is (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane.
Molecular Properties
| Compound Name | (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane |
| PubChem CID | 102064386 |
| Molecular Formula | C16H26Si3 |
| Molecular Weight | 302.64 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane |
| SMILES | C#CC1=C([Si](C)(C)C)[Si](C)(C)C([Si](C)(C)C)=C1C#C |
| InChI | InChI=1S/C16H26Si3/c1-11-13-14(12-2)16(18(6,7)8)19(9,10)15(13)17(3,4)5/h1-2H,3-10H3 |
| InChIKey | CJPAQDRQMODKHS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane?
The IUPAC name of (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane (CID 102064386) is (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane.
What is the SMILES notation for (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane?
The canonical SMILES for (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane is C#CC1=C([Si](C)(C)C)[Si](C)(C)C([Si](C)(C)C)=C1C#C.
What is the InChIKey of (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane?
The InChIKey is CJPAQDRQMODKHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26Si3/c1-11-13-14(12-2)16(18(6,7)8)19(9,10)15(13)17(3,4)5/h1-2H,3-10H3.
What are the key properties of (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane?
(3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane has a molecular weight of 302.64 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-diethynyl-1,1-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane is sourced from PubChem (CID 102064386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).