C16H6F5NO3 — CID 102064429
4-(2,3,4,5,6-pentafluorobenzoyl)-3-phenyl-4H-1,2-oxazol-5-one (PubChem CID 102064429) has the molecular formula C16H6F5NO3 and a molecular weight of 355.22 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentafluorobenzoyl)-3-phenyl-4H-1,2-oxazol-5-one.
| Compound Name | 4-(2,3,4,5,6-pentafluorobenzoyl)-3-phenyl-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 102064429 |
| Molecular Formula | C16H6F5NO3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 4-(2,3,4,5,6-pentafluorobenzoyl)-3-phenyl-4H-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(c2ccccc2)C1C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H6F5NO3/c17-9-7(10(18)12(20)13(21)11(9)19)15(23)8-14(22-25-16(8)24)6-4-2-1-3-5-6/h1-5,8H |
| InChIKey | HPQAVSVVQHKXOS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|