About methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane
methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane (PubChem CID 102064477) has the molecular formula C4H14Si2
and a molecular weight of 122.35 g/mol. Its IUPAC name is methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane.
Molecular Properties
| Compound Name | methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane |
| PubChem CID | 102064477 |
| Molecular Formula | C4H14Si2 |
| Molecular Weight | 122.35 g/mol |
| Exact Mass | 122.09 |
| IUPAC Name | methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane |
| SMILES | [2H]C([2H])([SiH2]C)C([2H])([2H])[SiH2]C |
| InChI | InChI=1S/C4H14Si2/c1-5-3-4-6-2/h3-6H2,1-2H3/i3D2,4D2 |
| InChIKey | CBXZGERYGLVXSG-KHORGVISSA-N |
| XLogP | 0.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.35 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane?
The IUPAC name of methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane (CID 102064477) is methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane.
What is the SMILES notation for methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane?
The canonical SMILES for methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane is [2H]C([2H])([SiH2]C)C([2H])([2H])[SiH2]C.
What is the InChIKey of methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane?
The InChIKey is CBXZGERYGLVXSG-KHORGVISSA-N. The full InChI is InChI=1S/C4H14Si2/c1-5-3-4-6-2/h3-6H2,1-2H3/i3D2,4D2.
What are the key properties of methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane?
methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane has a molecular weight of 122.35 g/mol, XLogP of 0.26, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(1,1,2,2-tetradeuterio-2-methylsilylethyl)silane is sourced from PubChem (CID 102064477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).