C6H18Si2 — CID 102064480
deuterio-dimethyl-[1,1,2,2-tetradeuterio-2-[deuterio(dimethyl)silyl]ethyl]silane (PubChem CID 102064480) has the molecular formula C6H18Si2 and a molecular weight of 152.42 g/mol. Its IUPAC name is deuterio-dimethyl-[1,1,2,2-tetradeuterio-2-[deuterio(dimethyl)silyl]ethyl]silane.
| Compound Name | deuterio-dimethyl-[1,1,2,2-tetradeuterio-2-[deuterio(dimethyl)silyl]ethyl]silane |
|---|---|
| PubChem CID | 102064480 |
| Molecular Formula | C6H18Si2 |
| Molecular Weight | 152.42 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | deuterio-dimethyl-[1,1,2,2-tetradeuterio-2-[deuterio(dimethyl)silyl]ethyl]silane |
| SMILES | [2H]C([2H])(C([2H])([2H])[Si]([2H])(C)C)[Si]([2H])(C)C |
| InChI | InChI=1S/C6H18Si2/c1-7(2)5-6-8(3)4/h7-8H,5-6H2,1-4H3/i5D2,6D2,7D,8D |
| InChIKey | YZJSARUCMYJHNV-QNBRLEJZSA-N |
| XLogP | 1.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|