C21H20O2 — CID 102064529
(1S,5R,6S,8S)-5,6-diphenyl-2-oxatricyclo[5.2.1.04,8]decan-3-one (PubChem CID 102064529) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (1S,5R,6S,8S)-5,6-diphenyl-2-oxatricyclo[5.2.1.04,8]decan-3-one.
| Compound Name | (1S,5R,6S,8S)-5,6-diphenyl-2-oxatricyclo[5.2.1.04,8]decan-3-one |
|---|---|
| PubChem CID | 102064529 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1S,5R,6S,8S)-5,6-diphenyl-2-oxatricyclo[5.2.1.04,8]decan-3-one |
| SMILES | O=C1O[C@H]2CC3[C@H](C2)C1[C@H](c1ccccc1)[C@H]3c1ccccc1 |
| InChI | InChI=1S/C21H20O2/c22-21-20-17-12-15(23-21)11-16(17)18(13-7-3-1-4-8-13)19(20)14-9-5-2-6-10-14/h1-10,15-20H,11-12H2/t15-,16?,17-,18-,19+,20?/m0/s1 |
| InChIKey | ZELHFNSIJMDNAC-QFDNIRHVSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |