C20H15O4+ — CID 102065241
4-(2-methoxybenzo[f]chromen-4-ium-3-yl)benzene-1,2-diol (PubChem CID 102065241) has the molecular formula C20H15O4+ and a molecular weight of 319.34 g/mol. Its IUPAC name is 4-(2-methoxybenzo[f]chromen-4-ium-3-yl)benzene-1,2-diol.
| Compound Name | 4-(2-methoxybenzo[f]chromen-4-ium-3-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 102065241 |
| Molecular Formula | C20H15O4+ |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 4-(2-methoxybenzo[f]chromen-4-ium-3-yl)benzene-1,2-diol |
| SMILES | COc1cc2c(ccc3ccccc32)[o+]c1-c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H14O4/c1-23-19-11-15-14-5-3-2-4-12(14)7-9-18(15)24-20(19)13-6-8-16(21)17(22)10-13/h2-11H,1H3,(H-,21,22)/p+1 |
| InChIKey | LLIMVJWENJNCEJ-UHFFFAOYSA-O |
| XLogP | 4.95 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|