About sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate
sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate (PubChem CID 102065491) has the molecular formula C6H7NaO9S
and a molecular weight of 278.17 g/mol. Its IUPAC name is sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate.
Molecular Properties
| Compound Name | sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate |
| PubChem CID | 102065491 |
| Molecular Formula | C6H7NaO9S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C([O-])=C1OS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C6H8O9S.Na/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13;/h2,4,7-9H,1H2,(H,11,12,13);/q;+1/p-1/t2-,4+;/m0./s1 |
| InChIKey | LRUISGPJGHTCRR-LEJBHHMKSA-M |
| XLogP | -6.34 |
| TPSA | 153.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | -6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate?
The IUPAC name of sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate (CID 102065491) is sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate.
What is the SMILES notation for sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate?
The canonical SMILES for sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate is O=C1O[C@H]([C@@H](O)CO)C([O-])=C1OS(=O)(=O)O.[Na+].
What is the InChIKey of sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate?
The InChIKey is LRUISGPJGHTCRR-LEJBHHMKSA-M. The full InChI is InChI=1S/C6H8O9S.Na/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13;/h2,4,7-9H,1H2,(H,11,12,13);/q;+1/p-1/t2-,4+;/m0./s1.
What are the key properties of sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate?
sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate has a molecular weight of 278.17 g/mol, XLogP of -6.34, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-sulfooxy-2H-furan-3-olate is sourced from PubChem (CID 102065491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).