About [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate
[(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate (PubChem CID 102065733) has the molecular formula C20H36O5Si
and a molecular weight of 384.59 g/mol. Its IUPAC name is [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate.
Molecular Properties
| Compound Name | [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate |
| PubChem CID | 102065733 |
| Molecular Formula | C20H36O5Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@H](OC(C)=O)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C20H36O5Si/c1-13(2)26(14(3)4,15(5)6)25-20-11-18(23-16(7)21)9-10-19(12-20)24-17(8)22/h9-10,13-15,18-20H,11-12H2,1-8H3/t18-,19+,20? |
| InChIKey | HPZWRGHSJJWFRF-YOFSQIOKSA-N |
| XLogP | 4.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate?
The IUPAC name of [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate (CID 102065733) is [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate.
What is the SMILES notation for [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate?
The canonical SMILES for [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate is CC(=O)O[C@@H]1C=C[C@H](OC(C)=O)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1.
What is the InChIKey of [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate?
The InChIKey is HPZWRGHSJJWFRF-YOFSQIOKSA-N. The full InChI is InChI=1S/C20H36O5Si/c1-13(2)26(14(3)4,15(5)6)25-20-11-18(23-16(7)21)9-10-19(12-20)24-17(8)22/h9-10,13-15,18-20H,11-12H2,1-8H3/t18-,19+,20?.
What are the key properties of [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate?
[(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate has a molecular weight of 384.59 g/mol, XLogP of 4.76, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,4R)-4-acetyloxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-yl] acetate is sourced from PubChem (CID 102065733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).