C12H17NO3 — CID 102066317
(2R,3S,4R)-3,4-bis(hydroxymethyl)-1-methyl-4-phenylazetidin-2-ol (PubChem CID 102066317) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (2R,3S,4R)-3,4-bis(hydroxymethyl)-1-methyl-4-phenylazetidin-2-ol.
| Compound Name | (2R,3S,4R)-3,4-bis(hydroxymethyl)-1-methyl-4-phenylazetidin-2-ol |
|---|---|
| PubChem CID | 102066317 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (2R,3S,4R)-3,4-bis(hydroxymethyl)-1-methyl-4-phenylazetidin-2-ol |
| SMILES | CN1[C@H](O)[C@H](CO)[C@]1(CO)c1ccccc1 |
| InChI | InChI=1S/C12H17NO3/c1-13-11(16)10(7-14)12(13,8-15)9-5-3-2-4-6-9/h2-6,10-11,14-16H,7-8H2,1H3/t10-,11+,12-/m0/s1 |
| InChIKey | YSHLPERUFOXVIE-TUAOUCFPSA-N |
| XLogP | -0.25 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |