C24H21Cl2NO6 — CID 10206632
4'-(tert-butylcarbamoyl)-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid (PubChem CID 10206632) has the molecular formula C24H21Cl2NO6 and a molecular weight of 490.34 g/mol. Its IUPAC name is 4'-(tert-butylcarbamoyl)-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid.
| Compound Name | 4'-(tert-butylcarbamoyl)-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid |
|---|---|
| PubChem CID | 10206632 |
| Molecular Formula | C24H21Cl2NO6 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 4'-(tert-butylcarbamoyl)-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid |
| SMILES | CC(C)(C)NC(=O)C1C(c2ccc(Cl)c(Cl)c2)OC2(C(=O)c3ccccc3C2=O)C1C(=O)O |
| InChI | InChI=1S/C24H21Cl2NO6/c1-23(2,3)27-21(30)16-17(22(31)32)24(19(28)12-6-4-5-7-13(12)20(24)29)33-18(16)11-8-9-14(25)15(26)10-11/h4-10,16-18H,1-3H3,(H,27,30)(H,31,32) |
| InChIKey | HYVGWFKZIHKIQE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|