C16H29NO3Si — CID 102066615
(1S,4S,5S)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methoxy-6-azabicyclo[3.2.0]hept-2-en-7-one (PubChem CID 102066615) has the molecular formula C16H29NO3Si and a molecular weight of 311.50 g/mol. Its IUPAC name is (1S,4S,5S)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methoxy-6-azabicyclo[3.2.0]hept-2-en-7-one.
| Compound Name | (1S,4S,5S)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methoxy-6-azabicyclo[3.2.0]hept-2-en-7-one |
|---|---|
| PubChem CID | 102066615 |
| Molecular Formula | C16H29NO3Si |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (1S,4S,5S)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methoxy-6-azabicyclo[3.2.0]hept-2-en-7-one |
| SMILES | CO[C@H]1C=C[C@@H]2C(=O)N(CCCO[Si](C)(C)C(C)(C)C)[C@H]12 |
| InChI | InChI=1S/C16H29NO3Si/c1-16(2,3)21(5,6)20-11-7-10-17-14-12(15(17)18)8-9-13(14)19-4/h8-9,12-14H,7,10-11H2,1-6H3/t12-,13-,14-/m0/s1 |
| InChIKey | YLULNIHNGPHSHK-IHRRRGAJSA-N |
| XLogP | 2.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|