C15H26O3 — CID 102066677
(2S,4S,5E,8S,9S)-4,8-dihydroxy-2,6-dimethyl-9-propan-2-ylcyclodec-5-en-1-one (PubChem CID 102066677) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (2S,4S,5E,8S,9S)-4,8-dihydroxy-2,6-dimethyl-9-propan-2-ylcyclodec-5-en-1-one.
| Compound Name | (2S,4S,5E,8S,9S)-4,8-dihydroxy-2,6-dimethyl-9-propan-2-ylcyclodec-5-en-1-one |
|---|---|
| PubChem CID | 102066677 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (2S,4S,5E,8S,9S)-4,8-dihydroxy-2,6-dimethyl-9-propan-2-ylcyclodec-5-en-1-one |
| SMILES | C/C1=C\[C@@H](O)C[C@H](C)C(=O)C[C@@H](C(C)C)[C@@H](O)C1 |
| InChI | InChI=1S/C15H26O3/c1-9(2)13-8-14(17)11(4)7-12(16)5-10(3)6-15(13)18/h5,9,11-13,15-16,18H,6-8H2,1-4H3/b10-5+/t11-,12+,13-,15-/m0/s1 |
| InChIKey | GXWMCJKALWREHJ-SZDLVHABSA-N |
| XLogP | 2.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|