About (3Z)-2-methylundeca-1,3-dien-5-yne
(3Z)-2-methylundeca-1,3-dien-5-yne (PubChem CID 102067427) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is (3Z)-2-methylundeca-1,3-dien-5-yne.
Molecular Properties
| Compound Name | (3Z)-2-methylundeca-1,3-dien-5-yne |
| PubChem CID | 102067427 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (3Z)-2-methylundeca-1,3-dien-5-yne |
| SMILES | C=C(C)/C=C\C#CCCCCC |
| InChI | InChI=1S/C12H18/c1-4-5-6-7-8-9-10-11-12(2)3/h10-11H,2,4-7H2,1,3H3/b11-10- |
| InChIKey | BRLULOXBYKNOOL-KHPPLWFESA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-methylundeca-1,3-dien-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-methylundeca-1,3-dien-5-yne?
The IUPAC name of (3Z)-2-methylundeca-1,3-dien-5-yne (CID 102067427) is (3Z)-2-methylundeca-1,3-dien-5-yne.
What is the SMILES notation for (3Z)-2-methylundeca-1,3-dien-5-yne?
The canonical SMILES for (3Z)-2-methylundeca-1,3-dien-5-yne is C=C(C)/C=C\C#CCCCCC.
What is the InChIKey of (3Z)-2-methylundeca-1,3-dien-5-yne?
The InChIKey is BRLULOXBYKNOOL-KHPPLWFESA-N. The full InChI is InChI=1S/C12H18/c1-4-5-6-7-8-9-10-11-12(2)3/h10-11H,2,4-7H2,1,3H3/b11-10-.
What are the key properties of (3Z)-2-methylundeca-1,3-dien-5-yne?
(3Z)-2-methylundeca-1,3-dien-5-yne has a molecular weight of 162.28 g/mol, XLogP of 3.70, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-methylundeca-1,3-dien-5-yne is sourced from PubChem (CID 102067427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).