C28H45NO4S — CID 10206750
[(2R,4S,6R,7S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(2-aminocyclohexyl)sulfanylacetate (PubChem CID 10206750) has the molecular formula C28H45NO4S and a molecular weight of 491.74 g/mol. Its IUPAC name is [(2R,4S,6R,7S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(2-aminocyclohexyl)sulfanylacetate.
| Compound Name | [(2R,4S,6R,7S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(2-aminocyclohexyl)sulfanylacetate |
|---|---|
| PubChem CID | 10206750 |
| Molecular Formula | C28H45NO4S |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | [(2R,4S,6R,7S)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(2-aminocyclohexyl)sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSC2CCCCC2N)[C@@]2(C)C(C)CCC3(CCC(=O)C32)[C@@H](C)C1O |
| InChI | InChI=1S/C28H45NO4S/c1-6-26(4)15-22(33-23(31)16-34-21-10-8-7-9-19(21)29)27(5)17(2)11-13-28(18(3)25(26)32)14-12-20(30)24(27)28/h6,17-19,21-22,24-25,32H,1,7-16,29H2,2-5H3/t17?,18-,19?,21?,22+,24?,25?,26+,27+,28?/m0/s1 |
| InChIKey | KRAHWDSJWFPQSF-JYXZVWFPSA-N |
| XLogP | 4.90 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|