C12H19NO3 — CID 102067688
(7aS)-5-(3,3-dimethyl-2-oxobutyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 102067688) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (7aS)-5-(3,3-dimethyl-2-oxobutyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | (7aS)-5-(3,3-dimethyl-2-oxobutyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 102067688 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (7aS)-5-(3,3-dimethyl-2-oxobutyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | CC(C)(C)C(=O)CC1CC[C@H]2COC(=O)N12 |
| InChI | InChI=1S/C12H19NO3/c1-12(2,3)10(14)6-8-4-5-9-7-16-11(15)13(8)9/h8-9H,4-7H2,1-3H3/t8?,9-/m0/s1 |
| InChIKey | VWKALLBREKDAIY-GKAPJAKFSA-N |
| XLogP | 1.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |