C27H25NO7 — CID 102068214
(E)-3-[2-methoxy-4-[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]oxyphenyl]prop-2-enoic acid (PubChem CID 102068214) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is (E)-3-[2-methoxy-4-[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-methoxy-4-[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102068214 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | (E)-3-[2-methoxy-4-[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]oxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(OC(=O)[C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C27H25NO7/c1-33-24-17-22(14-12-21(24)13-15-25(29)30)35-26(31)23(16-19-8-4-2-5-9-19)28-27(32)34-18-20-10-6-3-7-11-20/h2-15,17,23H,16,18H2,1H3,(H,28,32)(H,29,30)/b15-13+/t23-/m0/s1 |
| InChIKey | BZMSLZMZMFOMCU-JLQMKUNGSA-N |
| XLogP | 4.24 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|