C19H28O5 — CID 102068347
(3aR,3bR,6aR,7aR)-3b-hydroxy-6a-methoxy-7-methylidene-4,5-di(propan-2-yloxy)-2,3,3a,7a-tetrahydro-1H-cyclopenta[a]pentalen-6-one (PubChem CID 102068347) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (3aR,3bR,6aR,7aR)-3b-hydroxy-6a-methoxy-7-methylidene-4,5-di(propan-2-yloxy)-2,3,3a,7a-tetrahydro-1H-cyclopenta[a]pentalen-6-one.
| Compound Name | (3aR,3bR,6aR,7aR)-3b-hydroxy-6a-methoxy-7-methylidene-4,5-di(propan-2-yloxy)-2,3,3a,7a-tetrahydro-1H-cyclopenta[a]pentalen-6-one |
|---|---|
| PubChem CID | 102068347 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (3aR,3bR,6aR,7aR)-3b-hydroxy-6a-methoxy-7-methylidene-4,5-di(propan-2-yloxy)-2,3,3a,7a-tetrahydro-1H-cyclopenta[a]pentalen-6-one |
| SMILES | C=C1[C@@H]2CCC[C@H]2[C@@]2(O)C(OC(C)C)=C(OC(C)C)C(=O)[C@@]12OC |
| InChI | InChI=1S/C19H28O5/c1-10(2)23-15-16(20)19(22-6)12(5)13-8-7-9-14(13)18(19,21)17(15)24-11(3)4/h10-11,13-14,21H,5,7-9H2,1-4,6H3/t13-,14+,18+,19-/m0/s1 |
| InChIKey | CZFRXHXJLQHGCC-RAKLQZGLSA-N |
| XLogP | 2.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|