C18H30O4 — CID 102068368
(3aR,4R,5R,6R,6aR)-6a-hydroxy-3a,4,5,6-tetramethyl-2,3-di(propan-2-yloxy)-5,6-dihydro-4H-pentalen-1-one (PubChem CID 102068368) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (3aR,4R,5R,6R,6aR)-6a-hydroxy-3a,4,5,6-tetramethyl-2,3-di(propan-2-yloxy)-5,6-dihydro-4H-pentalen-1-one.
| Compound Name | (3aR,4R,5R,6R,6aR)-6a-hydroxy-3a,4,5,6-tetramethyl-2,3-di(propan-2-yloxy)-5,6-dihydro-4H-pentalen-1-one |
|---|---|
| PubChem CID | 102068368 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (3aR,4R,5R,6R,6aR)-6a-hydroxy-3a,4,5,6-tetramethyl-2,3-di(propan-2-yloxy)-5,6-dihydro-4H-pentalen-1-one |
| SMILES | CC(C)OC1=C(OC(C)C)[C@]2(C)[C@H](C)[C@@H](C)[C@@H](C)[C@]2(O)C1=O |
| InChI | InChI=1S/C18H30O4/c1-9(2)21-14-15(19)18(20)13(7)11(5)12(6)17(18,8)16(14)22-10(3)4/h9-13,20H,1-8H3/t11-,12-,13-,17+,18+/m1/s1 |
| InChIKey | GNQHNRVUAGVMDE-UGXSIPOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |