C16H34Si — CID 102069007
tert-butyl-[(E,4S)-dec-2-en-4-yl]-dimethylsilane (PubChem CID 102069007) has the molecular formula C16H34Si and a molecular weight of 254.53 g/mol. Its IUPAC name is tert-butyl-[(E,4S)-dec-2-en-4-yl]-dimethylsilane.
| Compound Name | tert-butyl-[(E,4S)-dec-2-en-4-yl]-dimethylsilane |
|---|---|
| PubChem CID | 102069007 |
| Molecular Formula | C16H34Si |
| Molecular Weight | 254.53 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | tert-butyl-[(E,4S)-dec-2-en-4-yl]-dimethylsilane |
| SMILES | C/C=C/C(CCCCCC)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34Si/c1-8-10-11-12-14-15(13-9-2)17(6,7)16(3,4)5/h9,13,15H,8,10-12,14H2,1-7H3/b13-9+ |
| InChIKey | OYGYXYGJAVPQAH-UKTHLTGXSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.53 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|