C11H14O4 — CID 102069685
(1S,9S)-1,9-dimethyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one (PubChem CID 102069685) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1S,9S)-1,9-dimethyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one.
| Compound Name | (1S,9S)-1,9-dimethyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one |
|---|---|
| PubChem CID | 102069685 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (1S,9S)-1,9-dimethyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one |
| SMILES | C[C@]12OCC3CC4C(=O)O[C@](C)(O1)C4C32 |
| InChI | InChI=1S/C11H14O4/c1-10-7-5(4-13-10)3-6-8(7)11(2,15-10)14-9(6)12/h5-8H,3-4H2,1-2H3/t5?,6?,7?,8?,10-,11+/m0/s1 |
| InChIKey | QAIWNLMEWQSQJA-ISTLTBPCSA-N |
| XLogP | 0.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |