C29H32N6O2 — CID 10206988
19-ethyl-4,12,14,19,25,27-hexazahexacyclo[23.6.1.17,14.02,6.08,13.026,31]tritriaconta-1(32),2(6),7(33),8(13),9,11,26(31),27,29-nonaene-3,5-dione (PubChem CID 10206988) has the molecular formula C29H32N6O2 and a molecular weight of 496.62 g/mol. Its IUPAC name is 19-ethyl-4,12,14,19,25,27-hexazahexacyclo[23.6.1.17,14.02,6.08,13.026,31]tritriaconta-1(32),2(6),7(33),8(13),9,11,26(31),27,29-nonaene-3,5-dione.
| Compound Name | 19-ethyl-4,12,14,19,25,27-hexazahexacyclo[23.6.1.17,14.02,6.08,13.026,31]tritriaconta-1(32),2(6),7(33),8(13),9,11,26(31),27,29-nonaene-3,5-dione |
|---|---|
| PubChem CID | 10206988 |
| Molecular Formula | C29H32N6O2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 19-ethyl-4,12,14,19,25,27-hexazahexacyclo[23.6.1.17,14.02,6.08,13.026,31]tritriaconta-1(32),2(6),7(33),8(13),9,11,26(31),27,29-nonaene-3,5-dione |
| SMILES | CCN1CCCCCn2cc(c3cccnc32)C2=C(C(=O)NC2=O)c2cn(c3ncccc23)CCCC1 |
| InChI | InChI=1S/C29H32N6O2/c1-2-33-14-4-3-5-16-34-18-22(20-10-8-12-30-26(20)34)24-25(29(37)32-28(24)36)23-19-35(17-7-6-15-33)27-21(23)11-9-13-31-27/h8-13,18-19H,2-7,14-17H2,1H3,(H,32,36,37) |
| InChIKey | FIHYVNNNXDBPSY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|