About ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate
ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate (PubChem CID 102070108) has the molecular formula C17H23NO2S2
and a molecular weight of 337.51 g/mol. Its IUPAC name is ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate.
Molecular Properties
| Compound Name | ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate |
| PubChem CID | 102070108 |
| Molecular Formula | C17H23NO2S2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate |
| SMILES | CCOC(=O)CS[C@H]1CC(=S)N(Cc2ccccc2)[C@H](C)C1 |
| InChI | InChI=1S/C17H23NO2S2/c1-3-20-17(19)12-22-15-9-13(2)18(16(21)10-15)11-14-7-5-4-6-8-14/h4-8,13,15H,3,9-12H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | OLLFSBDLGKOTAK-UKRRQHHQSA-N |
| XLogP | 3.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate?
The IUPAC name of ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate (CID 102070108) is ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate.
What is the SMILES notation for ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate?
The canonical SMILES for ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate is CCOC(=O)CS[C@H]1CC(=S)N(Cc2ccccc2)[C@H](C)C1.
What is the InChIKey of ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate?
The InChIKey is OLLFSBDLGKOTAK-UKRRQHHQSA-N. The full InChI is InChI=1S/C17H23NO2S2/c1-3-20-17(19)12-22-15-9-13(2)18(16(21)10-15)11-14-7-5-4-6-8-14/h4-8,13,15H,3,9-12H2,1-2H3/t13-,15-/m1/s1.
What are the key properties of ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate?
ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate has a molecular weight of 337.51 g/mol, XLogP of 3.66, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate is sourced from PubChem (CID 102070108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).