C17H23NO2S2 — CID 102070108
ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate (PubChem CID 102070108) has the molecular formula C17H23NO2S2 and a molecular weight of 337.51 g/mol. Its IUPAC name is ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate.
| Compound Name | ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate |
|---|---|
| PubChem CID | 102070108 |
| Molecular Formula | C17H23NO2S2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | ethyl 2-[(2R,4R)-1-benzyl-2-methyl-6-sulfanylidenepiperidin-4-yl]sulfanylacetate |
| SMILES | CCOC(=O)CS[C@H]1CC(=S)N(Cc2ccccc2)[C@H](C)C1 |
| InChI | InChI=1S/C17H23NO2S2/c1-3-20-17(19)12-22-15-9-13(2)18(16(21)10-15)11-14-7-5-4-6-8-14/h4-8,13,15H,3,9-12H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | OLLFSBDLGKOTAK-UKRRQHHQSA-N |
| XLogP | 3.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|