C36H45NO5Se — CID 102070160
(1R,2R,4R,7S,9S,12R)-8-[[2-[(4R,5S)-5-methoxyoctan-4-yl]selanylphenyl]methyl]-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane (PubChem CID 102070160) has the molecular formula C36H45NO5Se and a molecular weight of 650.72 g/mol. Its IUPAC name is (1R,2R,4R,7S,9S,12R)-8-[[2-[(4R,5S)-5-methoxyoctan-4-yl]selanylphenyl]methyl]-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane.
| Compound Name | (1R,2R,4R,7S,9S,12R)-8-[[2-[(4R,5S)-5-methoxyoctan-4-yl]selanylphenyl]methyl]-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane |
|---|---|
| PubChem CID | 102070160 |
| Molecular Formula | C36H45NO5Se |
| Molecular Weight | 650.72 g/mol |
| Exact Mass | 651.25 |
| IUPAC Name | (1R,2R,4R,7S,9S,12R)-8-[[2-[(4R,5S)-5-methoxyoctan-4-yl]selanylphenyl]methyl]-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane |
| SMILES | CCC[C@H](OC)[C@@H](CCC)[Se]c1ccccc1CN1[C@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]2O[C@H](c3ccccc3)OC[C@@H]21 |
| InChI | InChI=1S/C36H45NO5Se/c1-4-14-30(38-3)32(15-5-2)43-31-21-13-12-20-27(31)22-37-28-23-39-35(25-16-8-6-9-17-25)41-33(28)34-29(37)24-40-36(42-34)26-18-10-7-11-19-26/h6-13,16-21,28-30,32-36H,4-5,14-15,22-24H2,1-3H3/t28-,29-,30-,32+,33+,34+,35+,36+/m0/s1 |
| InChIKey | CCHPGWCBMOHGIH-UIWYEZJWSA-N |
| XLogP | 6.20 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.72 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|