C32H33NO6Se — CID 102070167
5-[[2-[[(1R,2R,4R,7S,9S,12R)-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecan-8-yl]methyl]phenyl]selanylmethyl]oxolan-2-one (PubChem CID 102070167) has the molecular formula C32H33NO6Se and a molecular weight of 606.58 g/mol. Its IUPAC name is 5-[[2-[[(1R,2R,4R,7S,9S,12R)-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecan-8-yl]methyl]phenyl]selanylmethyl]oxolan-2-one.
| Compound Name | 5-[[2-[[(1R,2R,4R,7S,9S,12R)-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecan-8-yl]methyl]phenyl]selanylmethyl]oxolan-2-one |
|---|---|
| PubChem CID | 102070167 |
| Molecular Formula | C32H33NO6Se |
| Molecular Weight | 606.58 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | 5-[[2-[[(1R,2R,4R,7S,9S,12R)-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecan-8-yl]methyl]phenyl]selanylmethyl]oxolan-2-one |
| SMILES | O=C1CCC(C[Se]c2ccccc2CN2[C@H]3CO[C@@H](c4ccccc4)O[C@H]3[C@@H]3O[C@H](c4ccccc4)OC[C@@H]32)O1 |
| InChI | InChI=1S/C32H33NO6Se/c34-28-16-15-24(37-28)20-40-27-14-8-7-13-23(27)17-33-25-18-35-31(21-9-3-1-4-10-21)38-29(25)30-26(33)19-36-32(39-30)22-11-5-2-6-12-22/h1-14,24-26,29-32H,15-20H2/t24?,25-,26-,29+,30+,31+,32+/m0/s1 |
| InChIKey | OEBOUSHCIZVSNK-WEIMNQPASA-N |
| XLogP | 3.92 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|