C23H17F6N3O3 — CID 10207019
4-cyano-N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]benzamide (PubChem CID 10207019) has the molecular formula C23H17F6N3O3 and a molecular weight of 497.40 g/mol. Its IUPAC name is 4-cyano-N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]benzamide.
| Compound Name | 4-cyano-N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 10207019 |
| Molecular Formula | C23H17F6N3O3 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 4-cyano-N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]benzamide |
| SMILES | CC(C)c1noc(NC(=O)c2ccc(C#N)cc2)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F6N3O3/c1-12(2)18-17(20(35-32-18)31-19(33)15-5-3-13(11-30)4-6-15)14-7-9-16(10-8-14)21(34,22(24,25)26)23(27,28)29/h3-10,12,34H,1-2H3,(H,31,33) |
| InChIKey | OJSCYSXEOSQDKL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |