C10H14 — CID 102070326
1-tert-butyl-3,5-dideuteriobenzene (PubChem CID 102070326) has the molecular formula C10H14 and a molecular weight of 136.23 g/mol. Its IUPAC name is 1-tert-butyl-3,5-dideuteriobenzene.
| Compound Name | 1-tert-butyl-3,5-dideuteriobenzene |
|---|---|
| PubChem CID | 102070326 |
| Molecular Formula | C10H14 |
| Molecular Weight | 136.23 g/mol |
| Exact Mass | 136.12 |
| IUPAC Name | 1-tert-butyl-3,5-dideuteriobenzene |
| SMILES | [2H]c1cc([2H])cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C10H14/c1-10(2,3)9-7-5-4-6-8-9/h4-8H,1-3H3/i5D,6D |
| InChIKey | YTZKOQUCBOVLHL-KCZCTXNHSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |