C13H20O3 — CID 102070629
ethyl (E)-3-[(2R,3R)-3-cyclohexyloxiran-2-yl]prop-2-enoate (PubChem CID 102070629) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,3R)-3-cyclohexyloxiran-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,3R)-3-cyclohexyloxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102070629 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | ethyl (E)-3-[(2R,3R)-3-cyclohexyloxiran-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1O[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C13H20O3/c1-2-15-12(14)9-8-11-13(16-11)10-6-4-3-5-7-10/h8-11,13H,2-7H2,1H3/b9-8+/t11-,13-/m1/s1 |
| InChIKey | KIDCDNDIANLRPZ-UULPFXLMSA-N |
| XLogP | 2.45 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|