C13H21BrO3 — CID 102070633
ethyl (E,4S,5R)-4-bromo-5-cyclohexyl-5-hydroxypent-2-enoate (PubChem CID 102070633) has the molecular formula C13H21BrO3 and a molecular weight of 305.21 g/mol. Its IUPAC name is ethyl (E,4S,5R)-4-bromo-5-cyclohexyl-5-hydroxypent-2-enoate.
| Compound Name | ethyl (E,4S,5R)-4-bromo-5-cyclohexyl-5-hydroxypent-2-enoate |
|---|---|
| PubChem CID | 102070633 |
| Molecular Formula | C13H21BrO3 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | ethyl (E,4S,5R)-4-bromo-5-cyclohexyl-5-hydroxypent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](Br)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C13H21BrO3/c1-2-17-12(15)9-8-11(14)13(16)10-6-4-3-5-7-10/h8-11,13,16H,2-7H2,1H3/b9-8+/t11-,13+/m0/s1 |
| InChIKey | YYKJRZRQQIYIBF-MDQMCFMNSA-N |
| XLogP | 2.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|