About 2-methylnaphthalene-1,4-dione
2-methylnaphthalene-1,4-dione (PubChem CID 102070817) has the molecular formula C11H8O2
and a molecular weight of 173.18 g/mol. Its IUPAC name is 2-methylnaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-methylnaphthalene-1,4-dione |
| PubChem CID | 102070817 |
| Molecular Formula | C11H8O2 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 2-methylnaphthalene-1,4-dione |
| SMILES | CC1=C[13C](=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3/i10+1 |
| InChIKey | MJVAVZPDRWSRRC-DETAZLGJSA-N |
| XLogP | 2.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-methylnaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylnaphthalene-1,4-dione?
The IUPAC name of 2-methylnaphthalene-1,4-dione (CID 102070817) is 2-methylnaphthalene-1,4-dione.
What is the SMILES notation for 2-methylnaphthalene-1,4-dione?
The canonical SMILES for 2-methylnaphthalene-1,4-dione is CC1=C[13C](=O)c2ccccc2C1=O.
What is the InChIKey of 2-methylnaphthalene-1,4-dione?
The InChIKey is MJVAVZPDRWSRRC-DETAZLGJSA-N. The full InChI is InChI=1S/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3/i10+1.
What are the key properties of 2-methylnaphthalene-1,4-dione?
2-methylnaphthalene-1,4-dione has a molecular weight of 173.18 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylnaphthalene-1,4-dione is sourced from PubChem (CID 102070817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).