C25H33NO5 — CID 102071176
[(1R,2S,5R)-5-methyl-2-[2-(4-nitrophenyl)propan-2-yl]cyclohexyl] (1R,6R)-5-oxobicyclo[4.2.0]octane-1-carboxylate (PubChem CID 102071176) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-[2-(4-nitrophenyl)propan-2-yl]cyclohexyl] (1R,6R)-5-oxobicyclo[4.2.0]octane-1-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-[2-(4-nitrophenyl)propan-2-yl]cyclohexyl] (1R,6R)-5-oxobicyclo[4.2.0]octane-1-carboxylate |
|---|---|
| PubChem CID | 102071176 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-[2-(4-nitrophenyl)propan-2-yl]cyclohexyl] (1R,6R)-5-oxobicyclo[4.2.0]octane-1-carboxylate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccc([N+](=O)[O-])cc2)[C@H](OC(=O)[C@@]23CCCC(=O)[C@@H]2CC3)C1 |
| InChI | InChI=1S/C25H33NO5/c1-16-6-11-20(24(2,3)17-7-9-18(10-8-17)26(29)30)22(15-16)31-23(28)25-13-4-5-21(27)19(25)12-14-25/h7-10,16,19-20,22H,4-6,11-15H2,1-3H3/t16-,19+,20-,22-,25-/m1/s1 |
| InChIKey | XEZONANXXPPLCT-FXPNMPDISA-N |
| XLogP | 5.37 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|