C31H34FN3O2 — CID 10207150
(2-fluorophenyl) N-[8-(2-methyl-4,5-diphenylimidazol-1-yl)octan-3-yl]carbamate (PubChem CID 10207150) has the molecular formula C31H34FN3O2 and a molecular weight of 499.63 g/mol. Its IUPAC name is (2-fluorophenyl) N-[8-(2-methyl-4,5-diphenylimidazol-1-yl)octan-3-yl]carbamate.
| Compound Name | (2-fluorophenyl) N-[8-(2-methyl-4,5-diphenylimidazol-1-yl)octan-3-yl]carbamate |
|---|---|
| PubChem CID | 10207150 |
| Molecular Formula | C31H34FN3O2 |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (2-fluorophenyl) N-[8-(2-methyl-4,5-diphenylimidazol-1-yl)octan-3-yl]carbamate |
| SMILES | CCC(CCCCCn1c(C)nc(-c2ccccc2)c1-c1ccccc1)NC(=O)Oc1ccccc1F |
| InChI | InChI=1S/C31H34FN3O2/c1-3-26(34-31(36)37-28-21-13-12-20-27(28)32)19-11-6-14-22-35-23(2)33-29(24-15-7-4-8-16-24)30(35)25-17-9-5-10-18-25/h4-5,7-10,12-13,15-18,20-21,26H,3,6,11,14,19,22H2,1-2H3,(H,34,36) |
| InChIKey | BDZLAFXHYNNBSK-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|