C19H16N2O3 — CID 102071790
14-butyl-18-oxa-14,16-diazatetracyclo[9.7.0.03,8.012,17]octadeca-1,3,5,7,9,11,16-heptaene-13,15-dione (PubChem CID 102071790) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 14-butyl-18-oxa-14,16-diazatetracyclo[9.7.0.03,8.012,17]octadeca-1,3,5,7,9,11,16-heptaene-13,15-dione.
| Compound Name | 14-butyl-18-oxa-14,16-diazatetracyclo[9.7.0.03,8.012,17]octadeca-1,3,5,7,9,11,16-heptaene-13,15-dione |
|---|---|
| PubChem CID | 102071790 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 14-butyl-18-oxa-14,16-diazatetracyclo[9.7.0.03,8.012,17]octadeca-1,3,5,7,9,11,16-heptaene-13,15-dione |
| SMILES | CCCCn1c(=O)nc2oc3cc4ccccc4ccc3c2c1=O |
| InChI | InChI=1S/C19H16N2O3/c1-2-3-10-21-18(22)16-14-9-8-12-6-4-5-7-13(12)11-15(14)24-17(16)20-19(21)23/h4-9,11H,2-3,10H2,1H3 |
| InChIKey | VBONGAZZOIZUNG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |