C12H15F9O4 — CID 102071902
(2S,3R,4S,5R)-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)oxane-3,4,5-triol (PubChem CID 102071902) has the molecular formula C12H15F9O4 and a molecular weight of 394.23 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102071902 |
| Molecular Formula | C12H15F9O4 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (2S,3R,4S,5R)-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC[C@H]1O |
| InChI | InChI=1S/C12H15F9O4/c13-9(14,10(15,16)11(17,18)12(19,20)21)3-1-2-6-8(24)7(23)5(22)4-25-6/h5-8,22-24H,1-4H2/t5-,6+,7+,8+/m1/s1 |
| InChIKey | ZRBUPRFIIIOWTN-KVPKETBZSA-N |
| XLogP | 2.11 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|