C17H22F2O11 — CID 102072404
ethyl (2S,4S,5S,6S)-2,4,5-triacetyloxy-6-(acetyloxymethyl)-3,3-difluorooxane-2-carboxylate (PubChem CID 102072404) has the molecular formula C17H22F2O11 and a molecular weight of 440.35 g/mol. Its IUPAC name is ethyl (2S,4S,5S,6S)-2,4,5-triacetyloxy-6-(acetyloxymethyl)-3,3-difluorooxane-2-carboxylate.
| Compound Name | ethyl (2S,4S,5S,6S)-2,4,5-triacetyloxy-6-(acetyloxymethyl)-3,3-difluorooxane-2-carboxylate |
|---|---|
| PubChem CID | 102072404 |
| Molecular Formula | C17H22F2O11 |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | ethyl (2S,4S,5S,6S)-2,4,5-triacetyloxy-6-(acetyloxymethyl)-3,3-difluorooxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(OC(C)=O)O[C@@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)C1(F)F |
| InChI | InChI=1S/C17H22F2O11/c1-6-25-15(24)17(29-11(5)23)16(18,19)14(28-10(4)22)13(27-9(3)21)12(30-17)7-26-8(2)20/h12-14H,6-7H2,1-5H3/t12-,13-,14-,17+/m0/s1 |
| InChIKey | LXLDITVVGLGIEC-AYMQEEERSA-N |
| XLogP | 0.27 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|