C19H31NO3 — CID 102072492
ethyl (1R,5S,9R)-3-ethyl-9-prop-2-enoxy-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate (PubChem CID 102072492) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is ethyl (1R,5S,9R)-3-ethyl-9-prop-2-enoxy-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate.
| Compound Name | ethyl (1R,5S,9R)-3-ethyl-9-prop-2-enoxy-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate |
|---|---|
| PubChem CID | 102072492 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | ethyl (1R,5S,9R)-3-ethyl-9-prop-2-enoxy-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate |
| SMILES | C=CCO[C@@H]1[C@]2(CC=C)CCC[C@@]1(C(=O)OCC)CN(CC)C2 |
| InChI | InChI=1S/C19H31NO3/c1-5-10-18-11-9-12-19(17(21)22-8-4,15-20(7-3)14-18)16(18)23-13-6-2/h5-6,16H,1-2,7-15H2,3-4H3/t16-,18-,19-/m1/s1 |
| InChIKey | KSKIOWDLRHQTCJ-BHIYHBOVSA-N |
| XLogP | 3.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|