C16H26O — CID 102073164
(1S,2S,5R)-5-methyl-1-prop-2-enoxy-1,2-bis(prop-1-en-2-yl)cyclohexane (PubChem CID 102073164) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (1S,2S,5R)-5-methyl-1-prop-2-enoxy-1,2-bis(prop-1-en-2-yl)cyclohexane.
| Compound Name | (1S,2S,5R)-5-methyl-1-prop-2-enoxy-1,2-bis(prop-1-en-2-yl)cyclohexane |
|---|---|
| PubChem CID | 102073164 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (1S,2S,5R)-5-methyl-1-prop-2-enoxy-1,2-bis(prop-1-en-2-yl)cyclohexane |
| SMILES | C=CCO[C@@]1(C(=C)C)C[C@H](C)CC[C@H]1C(=C)C |
| InChI | InChI=1S/C16H26O/c1-7-10-17-16(13(4)5)11-14(6)8-9-15(16)12(2)3/h7,14-15H,1-2,4,8-11H2,3,5-6H3/t14-,15+,16-/m1/s1 |
| InChIKey | DLOFNECTZARVKE-OWCLPIDISA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|