C17H28O2 — CID 102073165
(1S,2S,5R)-1-(1-ethoxyethenyl)-5-methyl-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexane (PubChem CID 102073165) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (1S,2S,5R)-1-(1-ethoxyethenyl)-5-methyl-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexane.
| Compound Name | (1S,2S,5R)-1-(1-ethoxyethenyl)-5-methyl-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexane |
|---|---|
| PubChem CID | 102073165 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (1S,2S,5R)-1-(1-ethoxyethenyl)-5-methyl-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexane |
| SMILES | C=CCO[C@@]1(C(=C)OCC)C[C@H](C)CC[C@H]1C(=C)C |
| InChI | InChI=1S/C17H28O2/c1-7-11-19-17(15(6)18-8-2)12-14(5)9-10-16(17)13(3)4/h7,14,16H,1,3,6,8-12H2,2,4-5H3/t14-,16+,17-/m1/s1 |
| InChIKey | SBXHQBZFPUEWDT-HYVNUMGLSA-N |
| XLogP | 4.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|